CAS 438616-66-1 appears in our catalog under these names: 2-(4-tert-Butylphenyl)cyclopropanecarbohydrazide, 95%, 2-(4-(tert-Butyl)phenyl)cyclopropanecarbohydrazide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-tert-butylphenyl)cyclopropane-1-carbohydrazide (CAS 438616-66-1) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: 2-(4-tert-butylphenyl)cyclopropane-1-carbohydrazide. InChIKey: XWQNNQGLRZLURU-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)cyclopropane-1-carbohydrazide |
| InChIKey | XWQNNQGLRZLURU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2CC2C(=O)NN |
Computed by PubChem (NCBI)