CAS 66648-43-9 appears in our catalog under these names: N-trans-Feruloyltyramine/ 99.81% (existing batch purity), N–trans–Feruloyltyramine, Moupinamide, N-trans-Feruloyltyramine (Standard), N-trans-Feruloyltyramine, 99.90%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, Get quote, 5 mg.
(E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide (CAS 66648-43-9) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide. InChIKey: NPNNKDMSXVRADT-WEVVVXLNSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| InChIKey | NPNNKDMSXVRADT-WEVVVXLNSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)NCCC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)