CAS 140652-55-7 appears in our catalog under these names: N1,N12-Di-boc-spermine, 95%, Di-tert-butyl ((butane-1,4-diylbis(azanediyl))bis(propane-3,1-diyl))dicarbamate, 95%, N1,N12–Di–boc–spermine, Spermine(BHHB), N1,N12-Di-boc-spermine, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 500mg, Get quote.
Tert-butyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butylamino]propyl]carbamate (CAS 140652-55-7) is a chemical compound with the molecular formula C20H42N4O4 and a molecular weight of 402.6 g/mol. IUPAC name: tert-butyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butylamino]propyl]carbamate. InChIKey: KBHLGUZPXGDPGO-UHFFFAOYSA-N.
| Molecular formula | C20H42N4O4 |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | tert-butyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butylamino]propyl]carbamate |
| InChIKey | KBHLGUZPXGDPGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCNCCCCNCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)