CAS 177213-61-5 appears in our catalog under these names: Spermine(hbbh), 98%, Spermine(HBBH), N4,N9-di-Boc-spermine 95%, Spermine(HBBH), 95%, 95%, N4,N9-di-Boc-spermine. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 1 g, 25 mg, 100 mg.
Tert-butyl N-(3-aminopropyl)-N-[4-[3-aminopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate (CAS 177213-61-5) is a chemical compound with the molecular formula C20H42N4O4 and a molecular weight of 402.6 g/mol. IUPAC name: tert-butyl N-(3-aminopropyl)-N-[4-[3-aminopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate. InChIKey: SXSUKFQJCFUOTC-UHFFFAOYSA-N.
| Molecular formula | C20H42N4O4 |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | tert-butyl N-(3-aminopropyl)-N-[4-[3-aminopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate |
| InChIKey | SXSUKFQJCFUOTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCCCN(CCCN)C(=O)OC(C)(C)C)CCCN |
Computed by PubChem (NCBI)