CAS 1874244-27-5 appears in our catalog under these names: N1,N2-Bis(4-(tert-butyl)phenyl)benzene-1,2-diamine, 95%, 95%, N1,N2-Bis(4-(tert-butyl)phenyl)benzene-1,2-diamine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-N,2-N-bis(4-tert-butylphenyl)benzene-1,2-diamine (CAS 1874244-27-5) is a chemical compound with the molecular formula C26H32N2 and a molecular weight of 372.5 g/mol. IUPAC name: 1-N,2-N-bis(4-tert-butylphenyl)benzene-1,2-diamine. InChIKey: FZYYWQKKBAOIKX-UHFFFAOYSA-N.
| Molecular formula | C26H32N2 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 1-N,2-N-bis(4-tert-butylphenyl)benzene-1,2-diamine |
| InChIKey | FZYYWQKKBAOIKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)NC2=CC=CC=C2NC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)