CAS 202832-48-2 appears in our catalog under these names: N1,N3-Bis(4-(tert-butyl)phenyl)benzene-1,3-diamine, 98%, 98%, N1,N3-Bis(4-(tert-butyl)phenyl)benzene-1,3-diamine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
1-N,3-N-bis(4-tert-butylphenyl)benzene-1,3-diamine (CAS 202832-48-2) is a chemical compound with the molecular formula C26H32N2 and a molecular weight of 372.5 g/mol. IUPAC name: 1-N,3-N-bis(4-tert-butylphenyl)benzene-1,3-diamine. InChIKey: NFWPHICGKMNNGG-UHFFFAOYSA-N.
| Molecular formula | C26H32N2 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 1-N,3-N-bis(4-tert-butylphenyl)benzene-1,3-diamine |
| InChIKey | NFWPHICGKMNNGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)NC2=CC(=CC=C2)NC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)