CAS 28898-03-5 appears in our catalog under these names: N1-(2-Fluorophenyl)benzene-1,2-diamine 98%, N-(2-Fluorophenyl)-1,2-diaminobenzene, 98%, 98%, N1-(2-Fluorophenyl)benzene-1,2-diamine, ≥98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-N-(2-fluorophenyl)benzene-1,2-diamine (CAS 28898-03-5) is a chemical compound with the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. IUPAC name: 2-N-(2-fluorophenyl)benzene-1,2-diamine. InChIKey: OYGRPIXAYJLZEN-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2 |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-N-(2-fluorophenyl)benzene-1,2-diamine |
| InChIKey | OYGRPIXAYJLZEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC2=CC=CC=C2F |
Computed by PubChem (NCBI)