CAS 1187386-28-2 is the registry number for 2-Fluoro-4-((4-methylpyridin-2-yl)methyl)pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]pyridine (CAS 1187386-28-2) is a chemical compound with the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. IUPAC name: 2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]pyridine. InChIKey: LNQNCCWYXSBFIL-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2 |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]pyridine |
| InChIKey | LNQNCCWYXSBFIL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)CC2=CC(=NC=C2)F |
Computed by PubChem (NCBI)