cas: 849035-93-4 — see every product listed under this CAS number, including other names
N1-[4-(Methylsulfonyl)-2-nitrophenyl]ethane-1,2-diamine (CAS 849035-93-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023663-1G |
| cas | 849035-93-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 1945.17 Pln |
| delivery time | 2-3 weeks |
|---|
N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine (CAS 849035-93-4) is a chemical compound with the molecular formula C9H13N3O4S and a molecular weight of 259.28 g/mol. IUPAC name: N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine. InChIKey: ZGBKVAJKDAKXKZ-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
| InChIKey | ZGBKVAJKDAKXKZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)NCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)