CAS 849035-93-4 appears in our catalog under these names: N-(2-Aminoethyl)-n-[4-(methylsulfonyl)-2-nitrophenyl]amine, 95%, N1-(4-(Methylsulfonyl)-2-nitrophenyl)ethane-1,2-diamine, 97%, N1-[4-(Methylsulfonyl)-2-nitrophenyl]ethane-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g.
N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine (CAS 849035-93-4) is a chemical compound with the molecular formula C9H13N3O4S and a molecular weight of 259.28 g/mol. IUPAC name: N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine. InChIKey: ZGBKVAJKDAKXKZ-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
| InChIKey | ZGBKVAJKDAKXKZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)NCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)