cas: 660838-05-1 — see every product listed under this CAS number, including other names
N1-Boc-4-methyl-1,3-phenylenediamine, 97%, 97% (CAS 660838-05-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117K70-250mg |
| cas | 660838-05-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Chemat | 25g | 2498.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3-amino-4-methylphenyl)carbamate (CAS 660838-05-1) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl N-(3-amino-4-methylphenyl)carbamate. InChIKey: HOVDUPXBRBXFBP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-methylphenyl)carbamate |
| InChIKey | HOVDUPXBRBXFBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)