CAS 862974-25-2 appears in our catalog under these names: N106/ 98.75% (existing batch purity), N106, N106 98%, N106, 98%, 98%, N106, 99.58%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
N-(4-methoxy-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine (CAS 862974-25-2) is a chemical compound with the molecular formula C17H14N4O3S and a molecular weight of 354.4 g/mol. IUPAC name: N-(4-methoxy-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: FBCSWQRNKAYAGY-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O3S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N-(4-methoxy-1,3-benzothiazol-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | FBCSWQRNKAYAGY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C(O2)NC3=NC4=C(C=CC=C4S3)OC |
Computed by PubChem (NCBI)