cas: 66382-22-7 — see every product listed under this CAS number, including other names
N2-(1-Ethylpropyl)-4,5-Dimethyl-3-Nitro-1,2-Benzenediamine, 95%, 95% (CAS 66382-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ARC-100mg |
| cas | 66382-22-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,5-dimethyl-3-nitro-2-N-pentan-3-ylbenzene-1,2-diamine (CAS 66382-22-7) is a chemical compound with the molecular formula C13H21N3O2 and a molecular weight of 251.32 g/mol. IUPAC name: 4,5-dimethyl-3-nitro-2-N-pentan-3-ylbenzene-1,2-diamine. InChIKey: DKAAQXSIAFALQW-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O2 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 4,5-dimethyl-3-nitro-2-N-pentan-3-ylbenzene-1,2-diamine |
| InChIKey | DKAAQXSIAFALQW-UHFFFAOYSA-N |
| SMILES | CCC(CC)NC1=C(C=C(C(=C1[N+](=O)[O-])C)C)N |
Computed by PubChem (NCBI)