CAS 2655557-82-5 is the registry number for tert-Butyl (4,5-diamino-2-methylphenyl)(methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(4,5-diamino-2-methylphenyl)-N-methylcarbamate (CAS 2655557-82-5) is a chemical compound with the molecular formula C13H21N3O2 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-(4,5-diamino-2-methylphenyl)-N-methylcarbamate. InChIKey: PABAMORQWKVCDM-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O2 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-(4,5-diamino-2-methylphenyl)-N-methylcarbamate |
| InChIKey | PABAMORQWKVCDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N(C)C(=O)OC(C)(C)C)N)N |
Computed by PubChem (NCBI)