cas: 823780-66-1 — see every product listed under this CAS number, including other names
N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N5-[(methylamino)(methylimino)methyl]-L-ornithine, 98%, 98% (CAS 823780-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1164H0-100mg |
| cas | 823780-66-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 774.80 Pln | |
| Chemat | 5g | 3050.00 Pln | |
| Chemat | 25g | 12006.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 823780-66-1) is a chemical compound with the molecular formula C23H28N4O4 and a molecular weight of 424.5 g/mol. IUPAC name: (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DQWCPMLQUQTZMJ-FQEVSTJZSA-N.
| Molecular formula | C23H28N4O4 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DQWCPMLQUQTZMJ-FQEVSTJZSA-N |
| SMILES | CNC(=NC)NCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)