cas: 1028077-12-4 — see every product listed under this CAS number, including other names
N2-Boc-guanine-9-acetic acid 97% (CAS 1028077-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A780491-100mg |
| cas | 1028077-12-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2450.75 Pln | |
| Ambeed | 10g | 4364.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A780491 |
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid (CAS 1028077-12-4) is a chemical compound with the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid. InChIKey: CALJQZKJKDPZDN-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O5 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid |
| InChIKey | CALJQZKJKDPZDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C(=O)N1)N=CN2CC(=O)O |
Computed by PubChem (NCBI)