cas: 1028077-12-4 — see every product listed under this CAS number, including other names
N2-BOC-GUANINE-9-ACETIC ACID, 95% (CAS 1028077-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F527535-100MG |
| cas | 1028077-12-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 966.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid (CAS 1028077-12-4) is a chemical compound with the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid. InChIKey: CALJQZKJKDPZDN-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O5 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetic acid |
| InChIKey | CALJQZKJKDPZDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C(=O)N1)N=CN2CC(=O)O |
Computed by PubChem (NCBI)