cas: 140712-79-4 — see every product listed under this CAS number, including other names
N6-Benzoyl-2'-deoxy-3'-O-DMT-adenosine 95% (CAS 140712-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A792976-100mg |
| cas | 140712-79-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A792976 |
N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 140712-79-4) is a chemical compound with the molecular formula C38H35N5O6 and a molecular weight of 657.7 g/mol. IUPAC name: N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: LFXBQKFIXWICJR-WIHCDAFUSA-N.
| Molecular formula | C38H35N5O6 |
|---|---|
| Molecular weight | 657.7 g/mol |
| IUPAC name | N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | LFXBQKFIXWICJR-WIHCDAFUSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@H]4C[C@@H](O[C@@H]4CO)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
Computed by PubChem (NCBI)