CAS 851398-76-0 appears in our catalog under these names: N6F11/ 99.76% (existing batch purity), N6F11, 2-(Chloromethyl)-6-(4-chlorophenyl)-3H,4H-thieno(3,2-d)pyrimidin-4-one, N6F11 95%, 2-(Chloromethyl)-6-(4-chlorophenyl)-3H,4H-thieno[3,2-d]pyrimidin-4-one, 95%, 95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 2,5g.
2-(chloromethyl)-6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 851398-76-0) is a chemical compound with the molecular formula C13H8Cl2N2OS and a molecular weight of 311.2 g/mol. IUPAC name: 2-(chloromethyl)-6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: KXALOVOFOCKYSD-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2OS |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 2-(chloromethyl)-6-(4-chlorophenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | KXALOVOFOCKYSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=O)NC(=N3)CCl)Cl |
Computed by PubChem (NCBI)