CAS 342779-66-2 appears in our catalog under these names: NCRW0005-F05/ 99.48% (existing batch purity), NCRW0005–F05, 3,3-Difluoro-4-(4-methoxyphenyl)-1-phenylazetidin-2-one, NCRW0005-F05, 99%, 99%, NCRW0005-F05, 99.94%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg, 5 mg, 50 mg.
3,3-difluoro-4-(4-methoxyphenyl)-1-phenylazetidin-2-one (CAS 342779-66-2) is a chemical compound with the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. IUPAC name: 3,3-difluoro-4-(4-methoxyphenyl)-1-phenylazetidin-2-one. InChIKey: AIIIYUSGINMZMS-UHFFFAOYSA-N.
| Molecular formula | C16H13F2NO2 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | 3,3-difluoro-4-(4-methoxyphenyl)-1-phenylazetidin-2-one |
| InChIKey | AIIIYUSGINMZMS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C(C(=O)N2C3=CC=CC=C3)(F)F |
Computed by PubChem (NCBI)