CAS 2446880-46-0 appears in our catalog under these names: ND-011992/ 99.7% (existing batch purity), ND–011992, ND-011992 98%, ND-011992, 98%, 98%, ND-011992, 98.26%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine (CAS 2446880-46-0) is a chemical compound with the molecular formula C21H14F3N3O and a molecular weight of 381.3 g/mol. IUPAC name: N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine. InChIKey: CAIODVXPWNFDFE-UHFFFAOYSA-N.
| Molecular formula | C21H14F3N3O |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine |
| InChIKey | CAIODVXPWNFDFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)OC4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)