CAS 2413940-56-2 appears in our catalog under these names: NF-κB/MAPK-IN-1/ 97.03% (existing batch purity), NF–κB/MAPK–IN–1, NF-κB/MAPK-IN-1, NF-κB/MAPK-IN-1, 98.71%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
(E)-N-[4-(2-acetyl-5-methoxyphenoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (CAS 2413940-56-2) is a chemical compound with the molecular formula C27H27NO7 and a molecular weight of 477.5 g/mol. IUPAC name: (E)-N-[4-(2-acetyl-5-methoxyphenoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide. InChIKey: PUWGXAJLVXPFFP-AWNIVKPZSA-N.
| Molecular formula | C27H27NO7 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (E)-N-[4-(2-acetyl-5-methoxyphenoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| InChIKey | PUWGXAJLVXPFFP-AWNIVKPZSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OC2=CC=C(C=C2)NC(=O)/C=C/C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)