CAS 1881244-28-5 appears in our catalog under these names: NF-1819/ 98.21% (existing batch purity), NF 1819, NF 1819, MGL-IN-1, ≥98%(HPLC), ≥98%(HPLC), MGL-IN-1, 99.21%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 50 mg, 100 mg.
(3R,4S)-4-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)-1-[1-(1,2,4-triazole-1-carbonyl)piperidin-4-yl]azetidin-2-one (CAS 1881244-28-5) is a chemical compound with the molecular formula C24H22FN5O4 and a molecular weight of 463.5 g/mol. IUPAC name: (3R,4S)-4-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)-1-[1-(1,2,4-triazole-1-carbonyl)piperidin-4-yl]azetidin-2-one. InChIKey: XRIROGBLGLPXQI-FGZHOGPDSA-N.
| Molecular formula | C24H22FN5O4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (3R,4S)-4-(1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)-1-[1-(1,2,4-triazole-1-carbonyl)piperidin-4-yl]azetidin-2-one |
| InChIKey | XRIROGBLGLPXQI-FGZHOGPDSA-N |
| SMILES | C1CN(CCC1N2[C@@H]([C@H](C2=O)C3=CC=C(C=C3)F)C4=CC5=C(C=C4)OCO5)C(=O)N6C=NC=N6 |
Computed by PubChem (NCBI)