CAS 1912422-56-0 appears in our catalog under these names: NFATc1-IN-1/ 99.64% (existing batch purity), NFATc1–IN–1, NFATc1-IN-1, NFATc1-IN-1, 99.97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 25 mg.
5-fluoro-N-(2-fluoro-4-iodophenyl)-2-hydroxybenzamide (CAS 1912422-56-0) is a chemical compound with the molecular formula C13H8F2INO2 and a molecular weight of 375.11 g/mol. IUPAC name: 5-fluoro-N-(2-fluoro-4-iodophenyl)-2-hydroxybenzamide. InChIKey: IGRCFOGPIJEESA-UHFFFAOYSA-N.
| Molecular formula | C13H8F2INO2 |
|---|---|
| Molecular weight | 375.11 g/mol |
| IUPAC name | 5-fluoro-N-(2-fluoro-4-iodophenyl)-2-hydroxybenzamide |
| InChIKey | IGRCFOGPIJEESA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)NC2=C(C=C(C=C2)I)F)O |
Computed by PubChem (NCBI)