cas: 252881-74-6 — see every product listed under this CAS number, including other names
NH2-PEG3-CH2CH2COOTBU, 95% (CAS 252881-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533415-250MG |
| cas | 252881-74-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 763.29 Pln | |
| Fluorochem | 25g | 1403.69 Pln | |
| Fluorochem | 100g | 4558.83 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate (CAS 252881-74-6) is a chemical compound with the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate. InChIKey: CWFSAZJIJBTKRC-UHFFFAOYSA-N.
| Molecular formula | C13H27NO5 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate |
| InChIKey | CWFSAZJIJBTKRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN |
Computed by PubChem (NCBI)