tert-Butyl 12-Amino-4,7,10-trioxadodecanoate, 98%, 98%
cas: 252881-74-6 — see every product listed under this CAS number, including other names
tert-Butyl 12-Amino-4,7,10-trioxadodecanoate, 98%, 98% (CAS 252881-74-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11476B-100mg |
| cas | 252881-74-6 |
| size | 100mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1802.00 Pln | |
| Chemat | 100g | 3165.20 Pln | |
| Chemat | 250g | 6952.40 Pln | |
| Chemat | 500g | 10459.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate (CAS 252881-74-6) is a chemical compound with the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate. InChIKey: CWFSAZJIJBTKRC-UHFFFAOYSA-N.
| Molecular formula | C13H27NO5 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate |
| InChIKey | CWFSAZJIJBTKRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 12-amino-4,7,10-trioxadodecanoate, Amino-PEG3-t-butyl ester, tert-butyl 3-(2-(2-(2-aminoethoxy)ethoxy)ethoxy)propanoate, Amino-PEG3-COOtBu, H2N-PEG3-CH2CH2COOtBu, tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate, H2N-PEG3-tBu, Propanoic acid, 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-, 1,1-dimethylethyl ester, Amine PEG3-t-butyl ester, H2N-PEG3-CH2CH2-t-butylester