CAS 1473450-62-2 appears in our catalog under these names: NITD-349/ 99.89% (existing batch purity), NITD–349, NITD-349 99%, NITD-349, 97%, 97%, NITD-349, 99.72%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide (CAS 1473450-62-2) is a chemical compound with the molecular formula C17H20F2N2O and a molecular weight of 306.35 g/mol. IUPAC name: N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide. InChIKey: UATYSFRIVIHVKL-UHFFFAOYSA-N.
| Molecular formula | C17H20F2N2O |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide |
| InChIKey | UATYSFRIVIHVKL-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)NC(=O)C2=CC3=C(N2)C=C(C=C3F)F)C |
Computed by PubChem (NCBI)