CAS 1414963-82-8 appears in our catalog under these names: NK-252/ 99.32% (existing batch purity), NK 252, NK-252 98%, 1-(5-(Furan-2-yl)-1,3,4-oxadiazol-2-yl)-3-(pyridin-2-ylmethyl)urea, 98%, 98%, NK-252, 99.60%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg.
1-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(pyridin-2-ylmethyl)urea (CAS 1414963-82-8) is a chemical compound with the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. IUPAC name: 1-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(pyridin-2-ylmethyl)urea. InChIKey: FNSCFQXZZNCDAI-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O3 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | 1-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(pyridin-2-ylmethyl)urea |
| InChIKey | FNSCFQXZZNCDAI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)NC2=NN=C(O2)C3=CC=CO3 |
Computed by PubChem (NCBI)