CAS 2641826-39-1 appears in our catalog under these names: (E)-3-(4-Bromo-2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one, 98%, 98%, NLRP3-IN-10, 98%, NLRP3-IN-10/ 99.63% (existing batch purity), NLRP3–IN–10. Offered by: Chemat, AmBeed, TargetMol, GLPBio. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 5mg, 200mg, 250mg.
(E)-3-(4-bromo-2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one (CAS 2641826-39-1) is a chemical compound with the molecular formula C17H14BrFO3 and a molecular weight of 365.2 g/mol. IUPAC name: (E)-3-(4-bromo-2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one. InChIKey: ZXMIFRJYIRYWTC-VMPITWQZSA-N.
| Molecular formula | C17H14BrFO3 |
|---|---|
| Molecular weight | 365.2 g/mol |
| IUPAC name | (E)-3-(4-bromo-2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | ZXMIFRJYIRYWTC-VMPITWQZSA-N |
| SMILES | COC1=CC(=C(C=C1/C=C/C(=O)C2=CC=C(C=C2)F)OC)Br |
Computed by PubChem (NCBI)