CAS 1807454-59-6 appears in our catalog under these names: NP–G2–044, NP-G2-044/ 99.87% (existing batch purity), NP-G2-044 98%, 2-Methyl-N-(1-(4-(trifluoromethyl)benzyl)-1H-indazol-3-yl)furan-3-carboxamide, 98%, 98%, NP-G2-044, 99.78%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 2mg.
2-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]furan-3-carboxamide (CAS 1807454-59-6) is a chemical compound with the molecular formula C21H16F3N3O2 and a molecular weight of 399.4 g/mol. IUPAC name: 2-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]furan-3-carboxamide. InChIKey: XLLRLAABUFOJPC-UHFFFAOYSA-N.
| Molecular formula | C21H16F3N3O2 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-methyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]indazol-3-yl]furan-3-carboxamide |
| InChIKey | XLLRLAABUFOJPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C(=O)NC2=NN(C3=CC=CC=C32)CC4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)