CAS 130089-98-4 appears in our catalog under these names: NQ301, 98%, 98%, NQ301/ 99.81% (existing batch purity), NQ301, NQ301, 98.98%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 100mg, 500mg, 1mg, 100 mg.
2-(4-acetylanilino)-3-chloronaphthalene-1,4-dione (CAS 130089-98-4) is a chemical compound with the molecular formula C18H12ClNO3 and a molecular weight of 325.7 g/mol. IUPAC name: 2-(4-acetylanilino)-3-chloronaphthalene-1,4-dione. InChIKey: LSQZKIQSQHZVQS-UHFFFAOYSA-N.
| Molecular formula | C18H12ClNO3 |
|---|---|
| Molecular weight | 325.7 g/mol |
| IUPAC name | 2-(4-acetylanilino)-3-chloronaphthalene-1,4-dione |
| InChIKey | LSQZKIQSQHZVQS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC2=C(C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)