CAS 2304503-05-5 appears in our catalog under these names: NQO1 substrate/ 98.02% (existing batch purity), Nqo1 substrate, NQO1 substrate, 98.02%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 25mg, 10mg, 50mg, 5mg, 50 mg, 10mM/1mL.
6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CAS 2304503-05-5) is a chemical compound with the molecular formula C13H2F2N4O and a molecular weight of 268.18 g/mol. IUPAC name: 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile. InChIKey: PZUSGRHVYDQLHR-UHFFFAOYSA-N.
| Molecular formula | C13H2F2N4O |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | 6,7-difluoro-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| InChIKey | PZUSGRHVYDQLHR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)C(=O)C3=NC(=C(N=C23)C#N)C#N |
Computed by PubChem (NCBI)