NR2E3 agonist 1
cas: 911211-69-3 — see every product listed under this CAS number, including other names
NR2E3 agonist 1 (CAS 911211-69-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T84349-1mg |
| cas | 911211-69-3 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 910.49 Pln | |
| TargetMol | 5mg | 1979.86 Pln | |
| TargetMol | 10mg | 3075.50 Pln | |
| TargetMol | 25mg | 5957.70 Pln | |
| TargetMol | 50mg | 7956.68 Pln | |
| TargetMol | 100mg | 10606.34 Pln | |
| GLPBio | 10mg | 2038.63 Pln | |
| GLPBio | 25mg | 3658.09 Pln | |
| GLPBio | 5mg | 1425.49 Pln | |
| Chemat | 1mg | 376.40 Pln | |
| Chemat | 5mg | 870.80 Pln | |
| Chemat | 10mg | 1370.00 Pln | |
| Chemat | 25mg | 2166.80 Pln | |
| Chemat | 50mg | 2901.20 Pln | |
| Chemat | 100mg | 3976.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
2-chloro-N-[4-[6-(cyclopropanecarbonylamino)-1H-benzimidazol-2-yl]phenyl]benzamide (CAS 911211-69-3) is a chemical compound with the molecular formula C24H19ClN4O2 and a molecular weight of 430.9 g/mol. IUPAC name: 2-chloro-N-[4-[6-(cyclopropanecarbonylamino)-1H-benzimidazol-2-yl]phenyl]benzamide. InChIKey: URTBMZWXWYUQAM-UHFFFAOYSA-N.
| Molecular formula | C24H19ClN4O2 |
|---|---|
| Molecular weight | 430.9 g/mol |
| IUPAC name | 2-chloro-N-[4-[6-(cyclopropanecarbonylamino)-1H-benzimidazol-2-yl]phenyl]benzamide |
| InChIKey | URTBMZWXWYUQAM-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CC3=C(C=C2)N=C(N3)C4=CC=C(C=C4)NC(=O)C5=CC=CC=C5Cl |
Computed by PubChem (NCBI)
Synonyms:
orb2308717