CAS 3010940-08-3 appears in our catalog under these names: NS2B/NS3–IN–2, NS2B/NS3-IN-2, 98.10%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 5 mg, 10 mg, 25 mg.
[5-amino-1-(4-ethoxyphenyl)sulfonylpyrazol-3-yl] 4-phenylbenzoate (CAS 3010940-08-3) is a chemical compound with the molecular formula C24H21N3O5S and a molecular weight of 463.5 g/mol. IUPAC name: [5-amino-1-(4-ethoxyphenyl)sulfonylpyrazol-3-yl] 4-phenylbenzoate. InChIKey: VHEJYZYHDWSAAG-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O5S |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | [5-amino-1-(4-ethoxyphenyl)sulfonylpyrazol-3-yl] 4-phenylbenzoate |
| InChIKey | VHEJYZYHDWSAAG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)N2C(=CC(=N2)OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)