CAS 17140-60-2 appears in our catalog under these names: NSC 42196/ 99.33% (existing batch purity), Calcium Gluceptate, a-D-Glucoheptonic acid calcium salt hydrate, CALCIUM GLUCOHEPTONATE, NSC 42196, 99.88%. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 500mg, 25g, 10g, 50g, 250g, 100g, 1EA.
Calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate) (CAS 17140-60-2) is a chemical compound with the molecular formula C14H26CaO16 and a molecular weight of 490.42 g/mol. IUPAC name: calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate). InChIKey: FATUQANACHZLRT-XBQZYUPDSA-L.
| Molecular formula | C14H26CaO16 |
|---|---|
| Molecular weight | 490.42 g/mol |
| IUPAC name | calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate) |
| InChIKey | FATUQANACHZLRT-XBQZYUPDSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.[Ca+2] |
Computed by PubChem (NCBI)