CAS 1796596-46-7 appears in our catalog under these names: NSC23005 Sodium/ 99.71% (existing batch purity), NSC 23005 (sodium salt), NSC23005 sodium, NSC23005 sodium, ≥98%, ≥98%, NSC23005 (sodium), 99.52%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL.
Sodium 4-(cyclohexylsulfamoyl)benzoate (CAS 1796596-46-7) is a chemical compound with the molecular formula C13H16NNaO4S and a molecular weight of 305.33 g/mol. IUPAC name: sodium 4-(cyclohexylsulfamoyl)benzoate. InChIKey: MLHFBDVMTRIQMW-UHFFFAOYSA-M.
| Molecular formula | C13H16NNaO4S |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | sodium 4-(cyclohexylsulfamoyl)benzoate |
| InChIKey | MLHFBDVMTRIQMW-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)