CAS 53868-26-1 appears in our catalog under these names: NSC305787 hydrochloride/ 99.07% (existing batch purity), NSC305787 hydrochloride, (Rac)-NSC305787 (hydrochloride), 99.07%, 99.07%, (Rac)-NSC305787 (hydrochloride), 98.18%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 50 mg.
[2-(1-adamantyl)-6,8-dichloroquinolin-4-yl]-piperidin-2-ylmethanol;hydrochloride (CAS 53868-26-1) is a chemical compound with the molecular formula C25H31Cl3N2O and a molecular weight of 481.9 g/mol. IUPAC name: [2-(1-adamantyl)-6,8-dichloroquinolin-4-yl]-piperidin-2-ylmethanol;hydrochloride. InChIKey: JQALIVSYOXLOBE-UHFFFAOYSA-N.
| Molecular formula | C25H31Cl3N2O |
|---|---|
| Molecular weight | 481.9 g/mol |
| IUPAC name | [2-(1-adamantyl)-6,8-dichloroquinolin-4-yl]-piperidin-2-ylmethanol;hydrochloride |
| InChIKey | JQALIVSYOXLOBE-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(C2=CC(=NC3=C2C=C(C=C3Cl)Cl)C45CC6CC(C4)CC(C6)C5)O.Cl |
Computed by PubChem (NCBI)