cas: 81624-55-7 — see every product listed under this CAS number, including other names
NSC348884, 99%, 99% (CAS 81624-55-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4SN-1mg |
| cas | 81624-55-7 |
| size | 1mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 107.60 Pln | |
| Chemat | 5mg | 112.40 Pln | |
| Chemat | 10mg | 165.20 Pln | |
| Chemat | 25mg | 232.40 Pln | |
| Chemat | 50mg | 381.20 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 2560.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine (CAS 81624-55-7) is a chemical compound with the molecular formula C38H40N10 and a molecular weight of 636.8 g/mol. IUPAC name: N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine. InChIKey: KZOLQEUQAFTQFM-UHFFFAOYSA-N.
| Molecular formula | C38H40N10 |
|---|---|
| Molecular weight | 636.8 g/mol |
| IUPAC name | N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine |
| InChIKey | KZOLQEUQAFTQFM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CN(CCN(CC3=NC4=C(N3)C=C(C=C4)C)CC5=NC6=C(N5)C=C(C=C6)C)CC7=NC8=C(N7)C=C(C=C8)C |
Computed by PubChem (NCBI)