CAS 81624-55-7 appears in our catalog under these names: NSC348884, NSC348884/ 99.65% (existing batch purity), NSC348884 99%, NSC348884, 99%, 99%, NSC348884, 99.40%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine (CAS 81624-55-7) is a chemical compound with the molecular formula C38H40N10 and a molecular weight of 636.8 g/mol. IUPAC name: N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine. InChIKey: KZOLQEUQAFTQFM-UHFFFAOYSA-N.
| Molecular formula | C38H40N10 |
|---|---|
| Molecular weight | 636.8 g/mol |
| IUPAC name | N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine |
| InChIKey | KZOLQEUQAFTQFM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CN(CCN(CC3=NC4=C(N3)C=C(C=C4)C)CC5=NC6=C(N5)C=C(C=C6)C)CC7=NC8=C(N7)C=C(C=C8)C |
Computed by PubChem (NCBI)