CAS 803647-40-7 appears in our catalog under these names: NSC59984/ 99.39% (existing batch purity), NSC59984, NSC59984 99%, 1-(4-Methylpiperazin-1-yl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one, 99%, 99%, NSC59984, 99.43%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 2mg.
(E)-1-(4-methylpiperazin-1-yl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one (CAS 803647-40-7) is a chemical compound with the molecular formula C12H15N3O4 and a molecular weight of 265.26 g/mol. IUPAC name: (E)-1-(4-methylpiperazin-1-yl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one. InChIKey: QKTRIGNWBRHBFV-DUXPYHPUSA-N.
| Molecular formula | C12H15N3O4 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (E)-1-(4-methylpiperazin-1-yl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one |
| InChIKey | QKTRIGNWBRHBFV-DUXPYHPUSA-N |
| SMILES | CN1CCN(CC1)C(=O)/C=C/C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)