CAS 157654-67-6 appears in our catalog under these names: NSC632839/ 99.74% (existing batch purity), NSC 632839 hydrochloride, NSC 632839, ≥98%, ≥98%, NSC632839, 98.87%, NSC632839 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL, 5 mg.
(3E,5E)-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one;hydrochloride (CAS 157654-67-6) is a chemical compound with the molecular formula C21H22ClNO and a molecular weight of 339.9 g/mol. IUPAC name: (3E,5E)-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one;hydrochloride. InChIKey: ZOKZLTXPTLIWOJ-BYCVLTJGSA-N.
| Molecular formula | C21H22ClNO |
|---|---|
| Molecular weight | 339.9 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one;hydrochloride |
| InChIKey | ZOKZLTXPTLIWOJ-BYCVLTJGSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C\2/C(=O)/C(=C/C3=CC=C(C=C3)C)/CNC2.Cl |
Computed by PubChem (NCBI)