CAS 3002056-30-3 appears in our catalog under these names: NST-628/ 98.62% (existing batch purity), NST–628, NST-628 96%, NST-628, NST-628, 98.61%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 10mM/1mL.
3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one (CAS 3002056-30-3) is a chemical compound with the molecular formula C22H18F2N4O5S and a molecular weight of 488.5 g/mol. IUPAC name: 3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one. InChIKey: YQSZJOABXRROQR-UHFFFAOYSA-N.
| Molecular formula | C22H18F2N4O5S |
|---|---|
| Molecular weight | 488.5 g/mol |
| IUPAC name | 3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one |
| InChIKey | YQSZJOABXRROQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC3=C(C=CC=N3)F)CC4=C(C(=NC=C4)NS(=O)(=O)NC)F |
Computed by PubChem (NCBI)