cas: 2055599-51-2 — see every product listed under this CAS number, including other names
NTP42, 96%, 96% (CAS 2055599-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KK07-1mg |
| cas | 2055599-51-2 |
| size | 1mg |
| availability | 0.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 467.60 Pln | |
| Chemat | 5mg | 544.40 Pln | |
| Chemat | 10mg | 818.00 Pln | |
| Chemat | 25mg | 1398.80 Pln | |
| Chemat | 50mg | 2037.20 Pln | |
| Chemat | 100mg | 3069.20 Pln | |
| Chemat | 250mg | 5474.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea (CAS 2055599-51-2) is a chemical compound with the molecular formula C25H23F2N3O5S and a molecular weight of 515.5 g/mol. IUPAC name: 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea. InChIKey: RIIKDGPBTPECSW-UHFFFAOYSA-N.
| Molecular formula | C25H23F2N3O5S |
|---|---|
| Molecular weight | 515.5 g/mol |
| IUPAC name | 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea |
| InChIKey | RIIKDGPBTPECSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)C1=C(C=CC(=C1)C#N)OC2=CC=CC(=C2)C3=CC=C(C=C3)OC(F)F |
Computed by PubChem (NCBI)