CAS 2055599-51-2 appears in our catalog under these names: Ntp42, 95%, NTP42/ 99.09% (existing batch purity), NTP42, NTP42 96%, NTP42, 96%, 96%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea (CAS 2055599-51-2) is a chemical compound with the molecular formula C25H23F2N3O5S and a molecular weight of 515.5 g/mol. IUPAC name: 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea. InChIKey: RIIKDGPBTPECSW-UHFFFAOYSA-N.
| Molecular formula | C25H23F2N3O5S |
|---|---|
| Molecular weight | 515.5 g/mol |
| IUPAC name | 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfonylurea |
| InChIKey | RIIKDGPBTPECSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)C1=C(C=CC(=C1)C#N)OC2=CC=CC(=C2)C3=CC=C(C=C3)OC(F)F |
Computed by PubChem (NCBI)