CAS 1817791-73-3 appears in our catalog under these names: NTRC 0066–0, NTRC 0066-0/ 98.3% (existing batch purity), NTRC 0066-0, NTRC 0066-0, 99.01%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 2mg, 5 mg, 10mM/1mL, 10 mg.
N-(2,6-diethylphenyl)-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrimido[4,5-e]indolizine-7-carboxamide (CAS 1817791-73-3) is a chemical compound with the molecular formula C33H39N7O2 and a molecular weight of 565.7 g/mol. IUPAC name: N-(2,6-diethylphenyl)-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrimido[4,5-e]indolizine-7-carboxamide. InChIKey: HGEIUFJVGHMGRR-UHFFFAOYSA-N.
| Molecular formula | C33H39N7O2 |
|---|---|
| Molecular weight | 565.7 g/mol |
| IUPAC name | N-(2,6-diethylphenyl)-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5,6-dihydropyrimido[4,5-e]indolizine-7-carboxamide |
| InChIKey | HGEIUFJVGHMGRR-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)NC(=O)C2=C3CCC4=CN=C(N=C4N3C=C2)NC5=C(C=C(C=C5)N6CCN(CC6)C)OC |
Computed by PubChem (NCBI)