CAS 300842-64-2 appears in our catalog under these names: NVP-ACC789/ 99.19% (existing batch purity), NVP-ACC789, NVP-ACC789 99%, N-(3-Bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine, 99%, 99%, NVP-ACC789, 99.52%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1mg, 5mg, 50 mg, 25 mg.
N-(3-bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine (CAS 300842-64-2) is a chemical compound with the molecular formula C21H17BrN4 and a molecular weight of 405.3 g/mol. IUPAC name: N-(3-bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine. InChIKey: GXWKSXUPEFVUOO-UHFFFAOYSA-N.
| Molecular formula | C21H17BrN4 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | N-(3-bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| InChIKey | GXWKSXUPEFVUOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NN=C(C3=CC=CC=C32)CC4=CC=NC=C4)Br |
Computed by PubChem (NCBI)