Products 902156-99-4
CAS 902156-99-4 appears in our catalog under these names: NVP-LCQ195/ 99.36% (existing batch purity), NVP–LCQ195, NVP-LCQ195, NVP-LCQ195, 98+%, 98+%, NVP-LCQ195, 98.81%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
4-[(2,6-dichlorobenzoyl)amino]-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide (CAS 902156-99-4) is a chemical compound with the molecular formula C17H19Cl2N5O4S and a molecular weight of 460.3 g/mol. IUPAC name: 4-[(2,6-dichlorobenzoyl)amino]-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide. InChIKey: CCUXEBOOTMDSAM-UHFFFAOYSA-N.
| Molecular formula | C17H19Cl2N5O4S |
|---|---|
| Molecular weight | 460.3 g/mol |
| IUPAC name | 4-[(2,6-dichlorobenzoyl)amino]-N-(1-methylsulfonylpiperidin-4-yl)-1H-pyrazole-5-carboxamide |
| InChIKey | CCUXEBOOTMDSAM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)NC(=O)C2=C(C=NN2)NC(=O)C3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)