CAS 2349367-89-9 appears in our catalog under these names: NVS-ZP7-4/ 98.41% (existing batch purity), NVS ZP7 4, NVS-ZP7-4 98%, NVS-ZP7-4, ≥98%, ≥98%, NVS-ZP7-4, 98.85%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
1'-[(2S)-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3-phenylpropyl]spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one (CAS 2349367-89-9) is a chemical compound with the molecular formula C28H28FN5OS and a molecular weight of 501.6 g/mol. IUPAC name: 1'-[(2S)-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3-phenylpropyl]spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one. InChIKey: FZOFDZMKSAUTHT-NRFANRHFSA-N.
| Molecular formula | C28H28FN5OS |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 1'-[(2S)-2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-3-phenylpropyl]spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one |
| InChIKey | FZOFDZMKSAUTHT-NRFANRHFSA-N |
| SMILES | C1CN(CCC12C3=CC=CC=C3NC(=O)N2)C[C@H](CC4=CC=CC=C4)NC5=NC6=C(S5)C=C(C=C6)F |
Computed by PubChem (NCBI)