CAS 886053-73-2 appears in our catalog under these names: NY2267, 98%, NY2267, NY2267/ 99.6% (existing batch purity), NY2267 95%, NY2267, 95%, 95%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 25mg, 50mg, 25 mg, 10mM/1mL.
Tert-butyl 2-[6-[2-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl-(pyridine-2-carbonyl)amino]-2-oxoethyl]naphthalen-2-yl]oxyacetate (CAS 886053-73-2) is a chemical compound with the molecular formula C38H43N3O6 and a molecular weight of 637.8 g/mol. IUPAC name: tert-butyl 2-[6-[2-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl-(pyridine-2-carbonyl)amino]-2-oxoethyl]naphthalen-2-yl]oxyacetate. InChIKey: RVGDACCXDZIPOB-UHFFFAOYSA-N.
| Molecular formula | C38H43N3O6 |
|---|---|
| Molecular weight | 637.8 g/mol |
| IUPAC name | tert-butyl 2-[6-[2-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl-(pyridine-2-carbonyl)amino]-2-oxoethyl]naphthalen-2-yl]oxyacetate |
| InChIKey | RVGDACCXDZIPOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC2=C(C=C1)C=C(C=C2)C(C(=O)NC3CCCCC3)N(CC4=CC=C(C=C4)OC)C(=O)C5=CC=CC=N5 |
Computed by PubChem (NCBI)