cas: 1523-11-1 — see every product listed under this CAS number, including other names
Naphthalen-2-yl acetate, 98% (CAS 1523-11-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235568-5G |
| cas | 1523-11-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 25g | 440.49 Pln | |
| Fluorochem | 100g | 1002.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Naphthalen-2-yl acetate (CAS 1523-11-1) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: naphthalen-2-yl acetate. InChIKey: RJNPPEUAJCEUPV-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | naphthalen-2-yl acetate |
| InChIKey | RJNPPEUAJCEUPV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)